You have no items in your shopping cart.
Cart summary
Dehydroabietal
Catalog Number: orb1942179
| Catalog Number | orb1942179 |
|---|---|
| Category | Small Molecules |
| Description | Dehydroabietal, a natural product, is present in Pinus brutia var. eldarica, Cedrus atlantica, and various other organisms [1]. |
| CAS Number | 13601-88-2 |
| Purity | 98.00% |
| MW | 284.44 |
| SMILES | C[C@@]12C=3C(CC[C@]1([C@@](C=O)(C)CCC2)[H])=CC(C(C)C)=CC3 |
| Formula | C20H28O |
| Biological Activity | Dehydroabietal, a natural product, is present in Pinus brutia var. eldarica, Cedrus atlantica, and various other organisms [1]. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
