You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1992478 |
---|---|
Category | Small Molecules |
Description | Carbamic acid |
Purity | 98.00% |
MW | 224.216 |
SMILES | CN(C)C(=O)OCc1ccc(cc1)[N+]([O-])=O |
Formula | C10H12N2O4 |
Biological Activity | Carbamic acid is a useful organic compound for research related to life sciences and the catalog number is orb1992478. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.00% | |
101491-88-7 | |
225.31 | |
C11H15NO2S |
98.00% | |
50539-94-1 | |
301.4 | |
C17H19NO2S |
98.00% | |
50539-96-3 | |
357.51 | |
C21H27NO2S |