You have no items in your shopping cart.
Cart summary
CA-4948
Catalog Number: orb1298434
| Catalog Number | orb1298434 |
|---|---|
| Category | Small Molecules |
| Description | CA-4948 |
| CAS Number | 1801344-14-8 |
| Purity | 99.62% |
| MW | 491.5 |
| SMILES | Cc1cc(ccn1)-c1nc(co1)C(=O)Nc1cc2oc(nc2nc1N1CC[C@@H](O)C1)N1CCOCC1 |
| Formula | C24H25N7O5 |
| Biological Activity | CA-4948 (Emavusertib) is a potent IRAK4/FLT3 inhibtor. CA-4948 with anti-tumor activity. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
