You have no items in your shopping cart.
Cart summary
BRL-37344
Catalog Number: orb2564345
| Catalog Number | orb2564345 |
|---|---|
| Category | Small Molecules |
| Description | BRL-37344 is a selective β3-adrenergic receptor agonist. It significantly reduces the body weight of obese mice. |
| Purity | 98.00% |
| MW | 363.84 |
| CAS Number | 90730-96-4 |
| Formula | C19H22ClNO4 |
| SMILES | [C@H](CN[C@H](CC1=CC=C(OCC(O)=O)C=C1)C)(O)C2=CC(Cl)=CC=C2 |
| Storage | -20°C |
| Note | For research use only |
