You have no items in your shopping cart.
Cart summary
Brexpiprazole HCl
Catalog Number: orb1298710
| Catalog Number | orb1298710 |
|---|---|
| Category | Small Molecules |
| Description | Brexpiprazole HCl |
| CAS Number | 913612-38-1 |
| Purity | 98% |
| MW | 433.6 |
| SMILES | Cl.O=c1ccc2ccc(OCCCCN3CCN(CC3)c3cccc4sccc34)cc2[nH]1 |
| Formula | C25H28ClN3O2S |
| Biological Activity | Brexpiprazole HCl (OPC 34712 dihydrochloride) is a new antipsychotic drug. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
