You have no items in your shopping cart.
Cart summary
| Catalog Number | orb1297770 |
|---|---|
| Category | Small Molecules |
| Description | BOS-318 |
| Purity | 99.06% |
| MW | 571.5 |
| Biological Activity | BOS-318 is a Furin inhibitor with slowly dissociating, highly selective, and cell-pemeable characteristcs. |
| CAS Number | 2387633-15-8 |
| Formula | C28H32Cl2N6O3 |
| SMILES | CN1CCN(CC1)c1ncc(Oc2cc(CN3CCC(CC(O)=O)CC3)cc(n2)-c2cc(Cl)cc(Cl)c2)cn1 |
| Storage | -20°C |
| Note | For research use only |
