You have no items in your shopping cart.
Cart summary
Beta-D-glucopyranosiduronic acid
Catalog Number: orb1992072
| Catalog Number | orb1992072 |
|---|---|
| Category | Small Molecules |
| Description | Beta-D-glucopyranosiduronic acid |
| Purity | 98.00% |
| MW | 448.38 |
| SMILES | O[C@@H]1[C@@H](O)[C@H](Oc2cc(O)c3C(=O)C[C@H](Oc3c2O)c2ccccc2)O[C@@H]([C@H]1O)C(O)=O |
| Formula | C21H20O11 |
| Biological Activity | Beta-D-glucopyranosiduronic acid is a useful organic compound for research related to life sciences and the catalog number is orb1992072. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
