You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1305085 |
---|---|
Category | Small Molecules |
Description | Aloin |
Purity | 99.89% |
MW | 418.39 |
Biological Activity | Aloin (Aloin-A)(mixture of A&B), a natural anthracycline from Aloe vera, is a tyrosinase inhibitor. |
CAS Number | [1415-73-2] |
Formula | C21H22O9 |
SMILES | OCC1OC(C(O)C(O)C1O)C1C2=CC=CC(O)=C2C(=O)C2=C1C=C(CO)C=C2O |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
8015-61-0 | |
418.4 | |
C21H22O9 |
> 98% (HPLC) | |
28371-16-6 | |
418.4 | |
C21H22O9 |
98.03% | |
[28371-16-6] | |
418.39 | |
C21H22O9 |
99.36% | |
[8015-61-0] |