You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1710785 |
---|---|
Category | Small Molecules |
Description | Ac4GalNAz is an alkyl chain-based PROTAC linker utilized in PROTAC synthesis. |
Purity | 98.31% |
MW | 430.37 |
Biological Activity | Ac4GalNAz is an alkyl chain-based PROTAC linker that can be used in PROTAC synthesis. |
CAS Number | 653600-56-7 |
Formula | C16H22N4O10 |
SMILES | CC(=O)OC[C@H]1OC(OC(C)=O)[C@H](NC(=O)CN=[N+]=[N-])[C@@H](OC(C)=O)[C@H]1OC(C)=O |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
653600-56-7 | |
430.37 | |
C16H22N4O10 |
mass identification (ESI-MS) | |
653600-56-7 | |
Theoretical MW: 430.37 g/mol; Detected MW: 430.13 g/mol | |
C16H22N4O10 |
mass identification (ESI-MS) | |
653600-56-7 | |
Theoretical MW: 430.37 g/mol; Detected MW: 430.13 g/mol | |
C16H22N4O10 |
mass identification (ESI-MS) | |
653600-56-7 | |
Theoretical MW: 430.37 g/mol; Detected MW: 430.13 g/mol | |
C16H22N4O10 |