You have no items in your shopping cart.
Cart summary
6-FITC
Catalog Number: orb1707747
| Catalog Number | orb1707747 |
|---|---|
| Category | Small Molecules |
| Description | 6-FITC |
| CAS Number | 3326-31-6 |
| Purity | 98% |
| MW | 389.38 |
| SMILES | O=C1OC2(C3=CC=C(O)C=C3OC4=CC(O)=CC=C42)C=5C=CC=C(N=C=S)C15 |
| Formula | C21H11NO5S |
| Biological Activity | 6-Fluorescein Isothiocyanate (6-FITC) is a fluorescein derivative widely employed in applications such as flow cytometry. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
