You have no items in your shopping cart.
Cart summary
3-Methylthienyl-carbonyl-JNJ-7706621
Catalog Number: orb1984475
| Catalog Number | orb1984475 |
|---|---|
| Category | Small Molecules |
| Description | 3-Methylthienyl-carbonyl-JNJ-7706621 is a highly potent and selective inhibitor of cyclin-dependent kinase (CDK), showing IC50 values of 6.4 nM for CDK1/cyclin B and 2 nM for CDK2/cyclin A. It also exhibits potent inhibition of GSK-3 (IC50 = 0.041 μM) and moderate inhibition of CDK4, VEGF-R2, and FGF-R2 (IC50 = 0.11 μM, 0.13 μM, and 0.22 μM, respectively), making it significant for cancer research. |
| CAS Number | 443798-09-2 |
| Purity | 98.00% |
| MW | 378.43 |
| SMILES | Cc1ccsc1C(=O)n1nc(Nc2ccc(cc2)S(N)(=O)=O)nc1N |
| Formula | C14H14N6O3S2 |
| Biological Activity | 3-Methylthienyl-carbonyl-JNJ-7706621 is a highly potent and selective inhibitor of cyclin-dependent kinase (CDK). It exhibits impressive IC50 values of 6.4 nM and 2 nM for CDK1/cyclin B and CDK2/cyclin A, respectively. Additionally, 3-Methylthienyl-carbonyl-JNJ-7706621 demonstrates potent inhibition against GSK-3 (IC50 = 0.041 μM) and moderate potency towards CDK4, VEGF-R2, and FGF-R2 (IC50 = 0.11 μM, 0.13 μM, and 0.22 μM, respectively). Its applications in cancer research are noteworthy. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
