You have no items in your shopping cart.
Cart summary
2'-Mant-3'-dATP
Catalog Number: orb1733997
| Catalog Number | orb1733997 |
|---|---|
| Category | Small Molecules |
| Description | 2'-Mant-3'-dATP |
| Form/Appearance | solution in water; Color: colorless to slightly yellow; pH: 7.5 ± 0.5 |
| Concentration | 10 mM-11 mM |
| Purity | ≥ 95% (HPLC) |
| MW | Theoretical MW: 624.33 g/mol (free acid); Detected MW: 624.05 g/mol (free acid) |
| Application notes | < b>Spectroscopic Propertie: λmax 255/355 nm, ε 23.3/5.8 L mmol-1 cm-1, (Tris-HCl pH 7.5), λexc 355 nm, λem 448 nm. |
| CAS Number | 313378-46-0 |
| Formula | C18H23N6O13P3 |
| SMILES | CNc1ccccc1C(=O)O[C@@H]1C[C@H](O[C@H]1n1c2c(nc1)c(N)ncn2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| Storage | store at -20 °C. Short term exposure (up to 1 week cumulative) to ambient temperature possible |
| Note | For research use only |
2'-Mant-3'-dATP [orb533110]
≥ 95% (HPLC)
313378-46-0
Theoretical MW: 624.33 g/mol (free acid); Detected MW: 624.05 g/mol (free acid)
C18H23N6O13P3
5 x 20 μl
