You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1305537 |
---|---|
Category | Small Molecules |
Description | Vonoprazan fumarate |
Purity | 99.98% |
MW | 461.46 |
Biological Activity | Vonoprazan fumarate (TAK-438) is a novel P-CAB (potassium-competitive acid blocker) that reversibly inhibits H+/K+, ATPase. |
CAS Number | [1260141-27-2] |
Formula | C17H16FN3O2S·C4H4O4 |
SMILES | CNCc1cn(c(c1)c1ccccc1F)S(=O)(=O)c1cnccc1.C(=C\C(=O)O)/C(=O)O |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
881681-01-2 | |
461.5 | |
C21H20FN3O6S |
≥98% | |
881681-01-2 | |
461.46 | |
C21H20FN3O6S |