You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1688808 |
---|---|
Category | Small Molecules |
Description | Verdinexor |
CAS Number | 1392136-43-4 |
Purity | 98.79% |
MW | 442.32 |
SMILES | FC(F)(F)c1cc(cc(c1)C(F)(F)F)-c1ncn(\C=C/C(=O)NNc2ccccn2)n1 |
Formula | C18H12F6N6O |
Biological Activity | Verdinexor (KPT-335) (KPT-335), a specific XPO1/CRM1 inhibitor, are orally bioavailable. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
[1392136-43-4] | |
442.32 | |
C18H12F6N6O |