You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1310879 |
---|---|
Category | Small Molecules |
Description | Urapidil |
Purity | 99.85% |
MW | 387.48 |
Biological Activity | Urapidil (Ebrantil), a sympatholytic antihypertensive drug, acts as a 5-HT1A receptor agonist and as an α1-adrenoceptor antagonist. |
CAS Number | [34661-75-1] |
Formula | C20H29N5O3 |
SMILES | O(C)C1=C(C=CC=C1)N2CCN(CCCNC=3N(C)C(=O)N(C)C(=O)C3)CC2 |
Storage | -20°C |
Note | For research use only |
> 98%(HPLC) | |
64887-14-5 | |
423.9 | |
C20H29N5O3·HCl |
99.93% | |
[64887-14-5] | |
423.94 | |
C20H29N5O3·HCl |