You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb401959 |
---|---|
Category | Small Molecules |
Description | Tubercidin, an adenosine analogue, is a nucleoside antibiotic. It is incorporated into DNA and inhibits polymerases, thereby inhibiting DNA replication and RNA and protein synthesis. This agent also exhibits antifungal and antiviral activities. |
CAS Number | [69-33-0] |
MW | 266.25 |
SMILES | NC1=C2C(N([C@H]3[C@@H]([C@@H]([C@@H](CO)O3)O)O)C=C2)=NC=N1 |
Formula | C11H14N4O4 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.38% | |
69-33-0 | |
266.25 | |
C11H14N4O4 |
0.999 | |
1854086-05-7 | |
334.25 | |
C12H13F3N4O4 |
98.00% | |
40627-31-4 | |
248.24 | |
C11H12N4O3 |
98.00% | |
40627-30-3 | |
234.25 | |
C11H14N4O2 |