You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1987628 |
---|---|
Category | Small Molecules |
Description | Thalidomide-NH-C6-NH2 is a synthetic conjugate designed as an E3 ligase ligand-linker, comprising a Thalidomide-based cereblon ligand connected to a specific linker used in PROTAC technology[1]. |
CAS Number | 2093386-50-4 |
Purity | 98.00% |
MW | 372.42 |
SMILES | O=C1NC(=O)C(N2C(=O)C=3C=CC=C(NCCCCCCN)C3C2=O)CC1 |
Formula | C19H24N4O4 |
Biological Activity | Thalidomide-NH-C6-NH2 is a synthetic conjugate compound designed as an E3 ligase ligand-linker. It consists of a Thalidomide-based cereblon ligand linked to a specific linker utilized in PROTAC technology[1]. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.27% | |
2375194-37-7 | |
408.88 | |
C19H25ClN4O4 |