You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1304595 |
---|---|
Category | Small Molecules |
Description | Teriflunomide |
Purity | 98.00% |
MW | 270.21 |
Biological Activity | (E/Z)-Teriflunomide (Aubagio), a orally-available Pyrimidine Synthesis Inhibitor, is used to treat relapsing multiple sclerosis. |
CAS Number | [108605-62-5] |
Formula | C12H9F3N2O2 |
SMILES | N#CC(C(=O)NC1=CC=C(C=C1)C(F)(F)F)=C(O)C |
Storage | -20°C |
Note | For research use only |
99.62% | |
1011244-72-6 | |
280.25 | |
C14H11F3N2O |