You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1299732 |
---|---|
Category | Small Molecules |
Description | Teriflunomide |
Purity | 99.95% |
MW | 270.21 |
Biological Activity | Teriflunomide (A 77-1726) is the principal active metabolite of leflunomide, an approved therapy for rheumatoid arthritis and multiple sclerosis. |
CAS Number | [163451-81-8] |
Formula | C12H9F3N2O2 |
SMILES | C(F)(F)(F)C1=CC=C(NC(/C(=C(/C)\O)/C#N)=O)C=C1 |
Storage | -20°C |
Note | For research use only |
98.00% | |
[108605-62-5] | |
270.21 | |
C12H9F3N2O2 |
99.62% | |
1011244-72-6 | |
280.25 | |
C14H11F3N2O |