You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb385579 |
---|---|
Category | Small Molecules |
Description | Tenofovir is an antiretroviral drug known as nucleotide analogue reverse transcriptase inhibitors (NRTIs), which block reverse transcriptase, a crucial virus enzyme in HIV-1 and HBV. |
CAS Number | [201341-05-1] |
MW | 519.44 |
SMILES | NC1=NC=NC2=C1N=CN2C[C@@H](C)OCP(OCOC(OC(C)C)=O)(OCOC(OC(C)C)=O)=O |
Formula | C19H30N5O10P |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
[202138-50-9] | |
635.5198 | |
C23H34N5O14P |
[1392275-56-7] | |
1069.00408 | |
2[C21H29N6O5P].C4H4O4 |
> 98%,Standard References | |
[1464851-21-5] | |
175.19 | |
C8H9N5 |
> 98%(HPLC) | |
202138-50-9 |
Filter by Rating