You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb181312 |
---|---|
Category | Small Molecules |
Description | Rostafuroxin: an ouabain-inhibitor counteracting specific forms of hypertension. |
CAS Number | [156722-18-8] |
MW | 374.51366 |
SMILES | C[C@]12CC[C@@H](C[C@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@@]3(CC[C@@]4(C5=COC=C5)O)O)C)O |
Formula | C23H34O4 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.08% | |
156722-18-8 | |
374.51 | |
C23H34O4 |