You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1707516 |
---|---|
Category | Small Molecules |
Description | Pramipexole dihydrochloride |
CAS Number | 104632-25-9 |
Purity | 98.00% |
MW | 247.79 |
SMILES | Cl.CCCN[C@H]1CCc2nc(N)sc2C1 |
Formula | C10H18ClN3S |
Biological Activity | Pramipexole dihydrochloride could be used to treat Parkinson disease. |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
≥98% | |
191217-81-9 | |
302.26 | |
C10H17N3S 2HCl H2O |
[191217-81-9] | |
302.2642391 | |
C10H21CL2N3OS |
99.55% | |
191217-81-9 | |
302.26 | |
C10H17N3S·2HCl·H2O |
Filter by Rating