You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1707516 |
---|---|
Category | Small Molecules |
Description | Pramipexole dihydrochloride |
Purity | 98.00% |
MW | 247.79 |
Biological Activity | Pramipexole dihydrochloride could be used to treat Parkinson disease. |
CAS Number | [104632-25-9] |
Formula | C10H18ClN3S |
SMILES | Cl.Cl.CCCN[C@H]1CCc2nc(N)sc2C1 |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
191217-81-9 | |
302.3 | |
C10H17N3S·2HCl·H2O |
98.00% | |
1217601-58-5 | |
289.28 | |
C10H14D5Cl2N3S |
99.55% | |
[191217-81-9] | |
302.26 | |
C10H17N3S·2HCl·H2O |