You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1310827 |
---|---|
Category | Small Molecules |
Description | Pioglitazone hydrochloride |
Purity | 99.66% |
MW | 392.9 |
Biological Activity | Pioglitazone hydrochloride (AD 4833) is the hydrochloride salt of an orally-active thiazolidinedione with antidiabetic properties and potential antineoplastic activity. |
CAS Number | [112529-15-4] |
Formula | C19H20N2O3S·HCl |
SMILES | Cl.CCc1ccc(CCOc2ccc(CC3SC(=O)NC3=O)cc2)nc1 |
Storage | -20°C |
Note | For research use only |
> 98%(HPLC) | |
112529-15-4 | |
392.9 | |
C19H20N2O3S·HCl |