You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1305448 |
---|---|
Category | Small Molecules |
Description | PF-562271 |
CAS Number | 717907-75-0 |
Purity | 97.65% |
MW | 507.49 |
SMILES | CN(c1ncccc1CNc1nc(Nc2ccc3NC(=O)Cc3c2)ncc1C(F)(F)F)S(C)(=O)=O |
Formula | C21H20F3N7O3S |
Biological Activity | PF-562271 is an effective ATP-competitive, reversible inhibitor of FAK(IC50=1.5 nM) and Pyk2 kinase(IC50=13 nM). |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.52% | |
939791-41-0 | |
543.95 | |
C21H20F3N7O3S HCl |
99.50% | |
939791-38-5 | |
665.66 | |
C27H26F3N7O6S2 |
[939791-38-5] | |
665.66 | |
C27H26F3N7O6S2 |