You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb321684 |
---|---|
Category | Proteins |
Description | Peptide Standard 1 |
Purity | ≥95% |
MW | 2153.52 |
Formula | C98H144N25O26S2 |
SMILES | [H]N[C@@H](CS)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)NCC(=O)N[C@@H](CC1=CNC=N1)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC1=CNC2=C1C=CC=C2)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC1=CC=C(O)C=C1)C(O)=O |
Storage | Storage Temp: -20°C |
Note | For research use only |
All | |
15.63-1000 pg/mL | |
4.18 pg/mL |
Porcine | |
15.63-1000 pg/mL | |
5.2 pg/mL |
Human | |
1.57-100 ng/mL | |
0.56 ng/mL |