You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1307460 |
---|---|
Category | Small Molecules |
Description | Parecoxib |
Purity | 99.90% |
MW | 370.42 |
Biological Activity | Parecoxib (SC 69124) is an effective and selective COX-2 inhibitor. |
CAS Number | [198470-84-7] |
Formula | C19H18N2O4S |
SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C3=CC=C(S(NC(CC)=O)(=O)=O)C=C3 |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
198470-84-7 | |
370.4 | |
C19H18N2O4S |
98.00% | |
[198470-85-8] | |
393.41 | |
C19H18N2NaO4S |