You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1299524 |
---|---|
Category | Small Molecules |
Description | Nonapeptide-1 |
Purity | 100.00% |
MW | 1206.5 |
Biological Activity | Nonapeptide-1 (Melanostatine 5) can inhibit the synthesis of melanin, which makes it of interest for treating certain skin conditions. |
CAS Number | [158563-45-2] |
Formula | C61H87N15O9S |
SMILES | CSCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(C)C)C(N)=O |
Storage | -20°C |
Note | For research use only |
98.26% | |
1266.58 | |
C63H91N15O11S |