You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb746500 |
---|---|
Category | Small Molecules |
Description | An orally available, brain penetrant p75NTR ligand that blocks p75-mediated cell death, also increases proliferation and survival of hippocampal neural progenitors. |
CAS Number | [1243259-19-9] |
MW | 316.267 |
SMILES | Cl.NC(C(C)CC)C(NCCN1CCOCC1)=O |
Formula | C12H27Cl2N3O2 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98% | |
1243259-19-9 | |
316.27 | |
C12H27Cl2N3O2 |