You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb342147 |
---|---|
Category | Small Molecules |
Description | Liothyronine sodium (T3 Sodium sal) is the most potent form of thyroid hormone used to treat hypothyroidism and myxedema coma. |
CAS Number | [55-06-1] |
MW | 672.96 |
SMILES | O=C([O-])[C@@H](N)CC1=CC(I)=C(OC2=CC=C(O)C(I)=C2)C(I)=C1.[Na+] |
Formula | C15H11I3NNaO4 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Chemical structure of Liothyronine sodium
98% | |
55-06-1 | |
672.96 | |
C15H11I3NNaO4 |
98% | |
345957-19-9 | |
0 | |
C15H11NNaO4 xH2O |