You have no items in your shopping cart.
Cart summary
Liothyronine sodium
Catalog Number: orb1307826
| Catalog Number | orb1307826 |
|---|---|
| Category | Small Molecules |
| Description | Liothyronine sodium |
| CAS Number | 55-06-1 |
| Purity | 98% |
| MW | 672.96 |
| SMILES | [Na+].N[C@@H](Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C([O-])=O |
| Formula | C15H11I3NNaO4 |
| Biological Activity | Liothyronine Sodium is the sodium salt form of liothyronine, a synthetic form of the levorotatory isomer of the naturally occurring thyroid hormone triiodothyronine (T3). Liothyronine sodium (3,3',5-Triiodo-L-thyronine sodium) binds to nuclear thyroid receptors which then bind to thyroid hormone response elements of target genes. As a result, liothyronine sodium induces gene expression that is required for normal growth and development. Liothyronine sodium is more potent and has a more rapid action than thyroxine (T4). |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
- Item 1 of 1
Liothyronine sodium hydrate [orb1685775]
98%
345957-19-9
0
C15H11NNaO4 xH2O
100 mg, 10 mg, 25 mg, 50 mg
