You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1303734 |
---|---|
Category | Small Molecules |
Description | Isosilybin |
Purity | 99.92% |
MW | 482.44 |
Biological Activity | Isosilybin (Isosilibinin) and Silybin might be suitable candidates to design potent PXR antagonists to prevent drug-drug interactions via CYP3A4 in cancer patients. |
CAS Number | [72581-71-6] |
Formula | C25H22O10 |
SMILES | COc1cc(ccc1O)C1Oc2ccc(cc2OC1CO)C1Oc2cc(O)cc(O)c2C(=O)[C@@H]1O |
Storage | -20°C |
Note | For research use only |
100.00% | |
[142796-22-3] | |
482.44 | |
C25H22O10 |
98.00% | |
[142796-21-2] | |
482.44 | |
C25H22O10 |