You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1298292 |
---|---|
Category | Small Molecules |
Description | IACS-13909 |
Purity | 98.80% |
MW | 377.27 |
Biological Activity | IACS-13909 (BBP-398), a specific and potent allosteric inhibitor of SHP2, that suppresses signaling through the MAPK pathway. |
CAS Number | [2160546-07-4] |
Formula | C17H18Cl2N6 |
SMILES | CC1(N)CCN(CC1)c1cnc2c(n[nH]c2n1)-c1cccc(Cl)c1Cl |
Storage | -20°C |
Note | For research use only |