You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb320520 |
---|---|
Category | Small Molecules |
Description | Farnesol |
CAS Number | 4602-84-0 |
Purity | ≥98% |
MW | 222.37 |
SMILES | CC(=CCCC(=CCCC(=CCO)C)C)C |
Formula | C15H26O |
Chemical Name | 3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol |
Hazard Information | Chemical Hazard Code: Xn, Xi, T. UN Number: Not dangerous goods |
Solubility (25°C) | Insoluble in water. |
Storage | Storage Temp: Ambient |
Note | For research use only |
Application notes | Clear, very light yellow, slightly viscous liquid |
Expiration Date | 12 months from date of receipt. |
FC, WB | |
Bovine, Canine, Equine, Porcine, Rat, Sheep | |
Human, Mouse | |
Rabbit | |
Polyclonal | |
Unconjugated |
ELISA, FC, IF | |
Bovine, Human | |
Goat | |
Polyclonal | |
Unconjugated |
FC, ICC, IF, WB | |
Human | |
Rabbit | |
Polyclonal | |
Unconjugated |