You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1307299 |
---|---|
Category | Small Molecules |
Description | Fabomotizole |
Purity | 99.56% |
MW | 307.41 |
Biological Activity | Fabomotizole (Obenoxazine) is an anxiolytic drug; produces anxiolytic and neuroprotective effects without any sedative or muscle relaxant actions. |
CAS Number | [173352-21-1] |
Formula | C15H21N3O2S |
SMILES | S(CCN1CCOCC1)C=2NC=3C(N2)=CC=C(OCC)C3 |
Storage | -20°C |
Note | For research use only |
98.00% | |
189638-30-0 | |
380.33 | |
C15H23Cl2N3O2S |
99.59% | |
[173352-39-1] | |
343.87 | |
C15H22ClN3O2S |