You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb134505 |
---|---|
Category | Small Molecules |
Description | Estradiol |
CAS Number | [50-28-2] |
MW | 272.38 |
SMILES | C[C@]1(CC2)[C@](CC[C@@H]1O)([H])[C@@]3([H])[C@@]2([H])C(C=CC(O)=C4)=C4CC3 |
Formula | C18H24O2 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Estradiol chemical structure
Chemical structure of Estradiol; beta-Estradiol, 17beta-Estradiol, Estrace, Dihydrofolliculin, Oestradiol, Dihydrotheelin, Dihydroxyestrin, Divigel
ICC, IHC, WB | |
Hamster | |
Human, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
IF, IH, WB | |
Human, Mouse, Porcine, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
ChIP, IF, IH, IP, WB | |
Human | |
Rabbit | |
Monoclonal | |
Unconjugated |
Filter by Rating