You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb134728 |
---|---|
Category | Small Molecules |
Description | Esomeprazole |
CAS Number | [119141-88-7] |
MW | 345.42 |
SMILES | O=S(CC1=C(C)C(OC)=C(C)C=N1)C2=NC(C=C3OC)=C(C=C3)N2 |
Formula | C17H19N3O3S |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
≥99% | |
217087-09-7 | |
767.17 | |
2(C17H18N3O3S) Mg 3H2O |
[217087-09-7] | |
767.1671 | |
C34H42MgN6O9S2 |
Filter by Rating