You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb104557 |
---|---|
Category | Small Molecules |
Description | (-)-Epigallocatechin gallate |
CAS Number | [989-51-5] |
Purity | > 98%,Standard References |
MW | 458.37 |
SMILES | O=C(C1=CC(O)=C(O)C(O)=C1)O[C@H]2[C@H](OC(C=C3O)=C(C(O)=C3)C2)C4=CC(O)=C(O)C(O)=C4 |
Formula | C22H18O11 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98% | |
83104-87-4 | |
472.4 | |
C23H20O11 |
99.34% | |
989-51-5 | |
458.37 | |
C22H18O11 |
> 98% (HPLC) | |
83104-87-4 | |
472.4 | |
C23H20O11 |