You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1300049 |
---|---|
Category | Small Molecules |
Description | Dinotefuran |
CAS Number | 165252-70-0 |
Purity | 98% |
MW | 202.21 |
SMILES | C(N=C(NN(=O)=O)NC)C1CCOC1 |
Formula | C7H14N4O3 |
Biological Activity | Dinotefuran (MTI-446) is an insecticide of the neonicotinoid class for control of insect pests such as aphids, whiteflies, thrips, leafhoppers, leafminers. Its mechanism of action involves disruption of the insect's nervous system by inhibiting nicotinic acetylcholine receptors. |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.00% | |
322639-07-6 | |
202.21 | |
C7H14N4O3 |
98.00% | |
406466-53-3 | |
202.21 | |
C7H14N4O3 |
Filter by Rating