You have no items in your shopping cart.
Cart summary
Dinotefuran-d3
Catalog Number: orb2281094
| Catalog Number | orb2281094 |
|---|---|
| Category | Small Molecules |
| Description | Dinotefuran-d3 is a deuterated compound of Dinotefuran. Dinotefuran has a CAS number of 165252-70-0. Dinotefuran is an insecticide of the neonicotinoid class for control of insect pests such as aphids, whiteflies, thrips, leafhoppers, leafminers. Its mechanism of action involves disruption of the insect's nervous system by inhibiting nicotinic acetylcholine receptors. |
| Purity | 98.00% |
| MW | 205.2295 |
| SMILES | [2H]C([2H])([2H])N/C(N[N+]([O-])=O)=N\CC1COCC1 |
| Formula | C7H11D3N4O3 |
| Biological Activity | Dinotefuran-d3 is a deuterated compound of Dinotefuran. Dinotefuran has a CAS number of 165252-70-0. Dinotefuran is an insecticide of the neonicotinoid class for control of insect pests such as aphids, whiteflies, thrips, leafhoppers, leafminers. Its mechanism of action involves disruption of the insect's nervous system by inhibiting nicotinic acetylcholine receptors. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
