You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1297979 |
---|---|
Category | Small Molecules |
Description | CK7 |
Purity | 98.07% |
MW | 328.35 |
Biological Activity | CK7, a Cdk2/9 inhibitor, is instrumental in the synthesis of Nek1 inhibitors BSc5231 and BSc5367. |
CAS Number | 507487-89-0 |
Formula | C14H12N6O2S |
SMILES | Cc1nc(N)sc1-c1ccnc(Nc2cccc(c2)[N+]([O-])=O)n1 |
Storage | -20°C |
Note | For research use only |
FC, IF, IHC-Fr, IHC-P, WB | |
Mouse, Rat | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
FC, ICC, IF, IHC-Fr, IHC-P, WB | |
Mouse, Rat | |
Human, Mouse, Rat | |
Mouse | |
Monoclonal | |
Unconjugated |
FACS, IF, IHC-P, WB | |
Human | |
Mouse | |
Monoclonal | |
Unconjugated |