You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb341542 |
---|---|
Category | Small Molecules |
Description | Canertinib (CI-1033) is a pan-ErbB?inhibitor for?EGFR?and?ErbB2?with?IC50?of 1.5 nM and 9.0 nM, no activity to PDGFR, FGFR, InsR, PKC, or CDK1/2/4. Phase 3. CI-1033 shows excellent potency for irreversible inhibition of erbB2 autophosphorylation in MDA-MB |
CAS Number | [267243-28-7] |
MW | 485.9444 |
SMILES | C=CC(NC1C=C2C(NC3=CC=C(F)C(Cl)=C3)=NC=NC2=CC=1OCCN1CCOCC1)=O |
Formula | C24H25ClFN5O3 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Chemical structure of Canertinib
[289499-45-2] | |
558.8603 | |
C24H27CL3FN5O3 |
≥98% | |
289499-45-2 | |
558.86 | |
C24H23ClFN5O3 2HCl |
99.23% | |
289499-45-2 | |
558.86 | |
C24H27Cl3FN5O3 |
99% | |
267243-28-7 | |
485.94 | |
C24H25ClFN5O3 |