You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1301044 |
---|---|
Category | Small Molecules |
Description | Canertinib |
CAS Number | 267243-28-7 |
Purity | 99% |
MW | 485.94 |
SMILES | Fc1ccc(Nc2ncnc3cc(OCCCN4CCOCC4)c(NC(=O)C=C)cc23)cc1Cl |
Formula | C24H25ClFN5O3 |
Biological Activity | Canertinib (CI-1033) is a pan-erbB tyrosine kinase inhibitor which work against esophageal squamous cell carcinoma in vitro and in vivo. Canertinib treatment significantly affects tumour metabolism, proliferation and hypoxia as determined by PET. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
[289499-45-2] | |
558.8603 | |
C24H27CL3FN5O3 |
[267243-28-7] | |
485.9444 | |
C24H25ClFN5O3 |
≥98% | |
289499-45-2 | |
558.86 | |
C24H23ClFN5O3 2HCl |
99.23% | |
289499-45-2 | |
558.86 | |
C24H27Cl3FN5O3 |