You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb341885 |
---|---|
Category | Small Molecules |
Description | Bazedoxifene is a selective estrogen receptor modulator (SERM) currently in development for osteoporosis prevention and treatment. |
MW | 470.6 |
CAS Number | [198481-32-2] |
Formula | C30H34N2O3 |
SMILES | CC1=C(N(C2=C1C=C(C=C2)O)CC3=CC=C(C=C3)OCCN4CCCCCC4)C5=CC=C(C=C5)O |
Note | For research use only |
> 98%(HPLC) | |
198481-33-3 | |
530.7 | |
C32H38N2O5 |
99.24% | |
[198481-33-3] | |
530.67 | |
C32H38N2O5 |
98.74% | |
198480-56-7 | |
507.06 | |
C30H35ClN2O3 |