You have no items in your shopping cart.
Cart summary
Anti-apoptotic agent 1
Catalog Number: orb2646109
| Catalog Number | orb2646109 |
|---|---|
| Category | Small Molecules |
| Description | Anti-apoptotic agent 1 (Compound B4) possesses neuroprotective activity and favorable pharmacokinetic properties. It inhibits cellular apoptosis and prevents photochemically induced stroke. |
| CAS Number | 2563616-64-6 |
| Purity | 98.00% |
| MW | 311.18 |
| SMILES | BrC=1C=CC(=C(C1)C2=NN=NN2)C(O)CCCC |
| Formula | C12H15BrN4O |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
