You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1734917 |
---|---|
Category | Small Molecules |
Description | 4-Azido-L-phenylalanine |
Form/Appearance | powder; Color: white to off-white |
Purity | ≥ 98% (HPLC) |
MW | Theoretical MW: 206.20 g/mol; Detected MW: 206.08 g/mol |
CAS Number | 33173-53-4 |
Formula | C9H10N4O2 |
SMILES | N(=[N+]=[N-])c1ccc(C[C@H](N)C(=O)O)cc1 |
Storage | store at -20 °C. store dry |
Note | For research use only |
≥ 98% (HPLC) | |
33173-53-4 | |
Theoretical MW: 206.20 g/mol; Detected MW: 206.08 g/mol | |
C9H10N4O2 |
≥ 98% (HPLC) | |
33173-53-4 | |
Theoretical MW: 206.20 g/mol; Detected MW: 206.08 g/mol | |
C9H10N4O2 |
> 98% (HPLC) | |
34670-43-4 | |
242.7 | |
C9H11ClN4O2 |
100.00% | |
34670-43-4 | |
242.66 | |
C9H11ClN4O2 |