You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1707751 |
---|---|
Category | Small Molecules |
Description | 4-Azido-L-phenylalanine |
Purity | 97.05% |
MW | 206.2 |
Biological Activity | 4-Azido-L-phenylalanine (p-Azido-L-phenylalanine) is an amino acid derivative that acts as a photoaffinity marker and can be used to detect localized protein environments. |
CAS Number | [33173-53-4] |
Formula | C9H10N4O2 |
SMILES | N[C@@H](CC1=CC=C(C=C1)N=[N+]=[N-])C(O)=O |
Storage | -20°C |
Note | For research use only |
≥ 98% (HPLC) | |
33173-53-4 | |
Theoretical MW: 206.20 g/mol; Detected MW: 206.08 g/mol | |
C9H10N4O2 |
≥ 98% (HPLC) | |
33173-53-4 | |
Theoretical MW: 206.20 g/mol; Detected MW: 206.08 g/mol | |
C9H10N4O2 |
≥ 98% (HPLC) | |
33173-53-4 | |
Theoretical MW: 206.20 g/mol; Detected MW: 206.08 g/mol | |
C9H10N4O2 |
> 98% (HPLC) | |
34670-43-4 | |
242.7 | |
C9H11ClN4O2 |
100.00% | |
34670-43-4 | |
242.66 | |
C9H11ClN4O2 |