You have no items in your shopping cart.
Cart summary
Wikstrol A
Catalog Number: orb1744357
| Catalog Number | orb1744357 |
|---|---|
| Category | Small Molecules |
| Description | Wikstrol A, a potent antifungal, antimitotic, and anti-HIV-1 agent, demonstrates significant effects across various biological targets. It induces morphological deformation in P. oryzae mycelia, with a minimum morphological deformation concentration (MMDC) of 70.1 µM and inhibits microtubule polymerization, evidenced by an IC50 value of 131 µM. Additionally, Wikstrol A exhibits anti-HIV-1 activity with an IC50 value of 67.8 µM. |
| CAS Number | 159736-35-3 |
| Purity | 98.00% |
| MW | 542.49 |
| SMILES | O=C1C(=C(OC=2C1=C(O)C=C(O)C2)C3=CC=C(O)C=C3)C4=C5C(CC(O)C(O5)C6=CC=C(O)C=C6)=C(O)C=C4O |
| Formula | C30H22O10 |
| Biological Activity | Wikstrol A, a potent antifungal, antimitotic, and anti-HIV-1 agent, demonstrates significant effects across various biological targets. It induces morphological deformation in P. oryzae mycelia, with a minimum morphological deformation concentration (MMDC) of 70.1 µM and inhibits microtubule polymerization, evidenced by an IC50 value of 131 µM. Additionally, Wikstrol A exhibits anti-HIV-1 activity with an IC50 value of 67.8 µM. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
