You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb181348 |
---|---|
Category | Small Molecules |
Description | Walrycin B is a novel antibacterial compound specifically targeting the essential WalR response regulator. |
CAS Number | [878419-78-4] |
MW | 337.26 |
SMILES | N(C)1C2=NC(=O)N(C)C(=O)C2=NC(C2=CC=C(C(F)(F)F)C=C2)=N1 |
Formula | C14H10F3N5O2 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
> 98% (HPLC) | |
878419-78-4 |
99.16% | |
878419-78-4 | |
337.26 | |
C14H10F3N5O2 |
Filter by Rating