You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1307395 |
---|---|
Category | Small Molecules |
Description | VGX-1027 |
Purity | 99.86% |
MW | 205.21 |
Biological Activity | VGX-1027 (GIT 27) is an isoxazole compound with various immunomodulatory properties. |
CAS Number | [6501-72-0] |
Formula | C11H11NO3 |
SMILES | OC(=O)CC1CC(=NO1)c1ccccc1 |
Storage | -20°C |
Note | For research use only |
> 98%(HPLC) | |
6501-72-0 | |
205.2 | |
C11H11NO3 |