You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1303812 |
---|---|
Category | Small Molecules |
Description | Veratric acid |
Purity | 99.95% |
MW | 182.17 |
Biological Activity | Veratric acid (3,4-Dimethoxybenzoic acid) is a simple benzoic acid derived from plants and fruits with anti-oxidant, anti-inflammation and blood pressure-lowering effects. |
CAS Number | [93-07-2] |
Formula | C9H10O4 |
SMILES | COC1=C(OC)C=C(C=C1)C(O)=O |
Storage | -20°C |
Note | For research use only |